C12H14ClNO4 — CID 61150233
ethyl (3S)-3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate (PubChem CID 61150233) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate.
| Compound Name | ethyl (3S)-3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 61150233 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | ethyl (3S)-3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C12H14ClNO4/c1-2-16-11(15)5-9(14)7-3-8(13)12-10(4-7)17-6-18-12/h3-4,9H,2,5-6,14H2,1H3/t9-/m0/s1 |
| InChIKey | NZLDJXBZZRCPBD-VIFPVBQESA-N |
| XLogP | 2.02 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |