C13H16ClNO4 — CID 43803679
2-(7-chloro-1,3-benzodioxol-5-yl)-2-(diethylamino)acetic acid (PubChem CID 43803679) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(diethylamino)acetic acid.
| Compound Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(diethylamino)acetic acid |
|---|---|
| PubChem CID | 43803679 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(diethylamino)acetic acid |
| SMILES | CCN(CC)C(C(=O)O)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H16ClNO4/c1-3-15(4-2)11(13(16)17)8-5-9(14)12-10(6-8)18-7-19-12/h5-6,11H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | LPOZVXQPEAWYFO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |