C10H11ClO2 — CID 58332059
4-chloro-6-propan-2-yl-1,3-benzodioxole (PubChem CID 58332059) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 4-chloro-6-propan-2-yl-1,3-benzodioxole.
| Compound Name | 4-chloro-6-propan-2-yl-1,3-benzodioxole |
|---|---|
| PubChem CID | 58332059 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 4-chloro-6-propan-2-yl-1,3-benzodioxole |
| SMILES | CC(C)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C10H11ClO2/c1-6(2)7-3-8(11)10-9(4-7)12-5-13-10/h3-4,6H,5H2,1-2H3 |
| InChIKey | QOGBNVZFKMUQBS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |