C11H10Cl2O2 — CID 130539083
4-chloro-6-[(E)-3-chlorobut-1-enyl]-1,3-benzodioxole (PubChem CID 130539083) has the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. Its IUPAC name is 4-chloro-6-[(E)-3-chlorobut-1-enyl]-1,3-benzodioxole.
| Compound Name | 4-chloro-6-[(E)-3-chlorobut-1-enyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 130539083 |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.10 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 4-chloro-6-[(E)-3-chlorobut-1-enyl]-1,3-benzodioxole |
| SMILES | CC(Cl)/C=C/c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H10Cl2O2/c1-7(12)2-3-8-4-9(13)11-10(5-8)14-6-15-11/h2-5,7H,6H2,1H3/b3-2+ |
| InChIKey | IBAKPFRILDIQNZ-NSCUHMNNSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|