C17H19ClN2O4 — CID 100849387
(3R,6R)-1-[(Z)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide (PubChem CID 100849387) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is (3R,6R)-1-[(Z)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3R,6R)-1-[(Z)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 100849387 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (3R,6R)-1-[(Z)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)/C=C\c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C17H19ClN2O4/c1-10-2-4-12(17(19)22)8-20(10)15(21)5-3-11-6-13(18)16-14(7-11)23-9-24-16/h3,5-7,10,12H,2,4,8-9H2,1H3,(H2,19,22)/b5-3-/t10-,12-/m1/s1 |
| InChIKey | KYJQQZVZCYNIHJ-SIIXBRRKSA-N |
| XLogP | 2.19 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|