C17H17ClN4O4 — CID 126773273
3-(7-chloro-1,3-benzodioxol-5-yl)-1-[3-[4-(1-hydroxyethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 126773273) has the molecular formula C17H17ClN4O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is 3-(7-chloro-1,3-benzodioxol-5-yl)-1-[3-[4-(1-hydroxyethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(7-chloro-1,3-benzodioxol-5-yl)-1-[3-[4-(1-hydroxyethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 126773273 |
| Molecular Formula | C17H17ClN4O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-(7-chloro-1,3-benzodioxol-5-yl)-1-[3-[4-(1-hydroxyethyl)triazol-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | CC(O)c1cn(C2CN(C(=O)C=Cc3cc(Cl)c4c(c3)OCO4)C2)nn1 |
| InChI | InChI=1S/C17H17ClN4O4/c1-10(23)14-8-22(20-19-14)12-6-21(7-12)16(24)3-2-11-4-13(18)17-15(5-11)25-9-26-17/h2-5,8,10,12,23H,6-7,9H2,1H3 |
| InChIKey | KLHYOIAHHDCUMK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|