C17H18ClNO5 — CID 126794675
1-[3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 126794675) has the molecular formula C17H18ClNO5 and a molecular weight of 351.79 g/mol. Its IUPAC name is 1-[3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 126794675 |
| Molecular Formula | C17H18ClNO5 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-[3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)C=Cc2cc(Cl)c3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C17H18ClNO5/c18-13-8-11(9-14-16(13)24-7-6-23-14)3-4-15(20)19-5-1-2-12(10-19)17(21)22/h3-4,8-9,12H,1-2,5-7,10H2,(H,21,22) |
| InChIKey | WPCONENPQHYQGZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|