C19H23ClN2O4 — CID 49402728
1-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-N-propylpiperidine-3-carboxamide (PubChem CID 49402728) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is 1-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-N-propylpiperidine-3-carboxamide.
| Compound Name | 1-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 49402728 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)C1CCCN(C(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)C1 |
| InChI | InChI=1S/C19H23ClN2O4/c1-2-7-21-19(24)14-4-3-8-22(11-14)17(23)6-5-13-9-15(20)18-16(10-13)25-12-26-18/h5-6,9-10,14H,2-4,7-8,11-12H2,1H3,(H,21,24)/b6-5+ |
| InChIKey | OQHYYMAXEHKJOA-AATRIKPKSA-N |
| XLogP | 2.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|