C18H21ClN2O4 — CID 46564647
1-[4-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]piperazin-1-yl]-2-methylpropan-1-one (PubChem CID 46564647) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 1-[4-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]piperazin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]piperazin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 46564647 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[4-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]piperazin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(C(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H21ClN2O4/c1-12(2)18(23)21-7-5-20(6-8-21)16(22)4-3-13-9-14(19)17-15(10-13)24-11-25-17/h3-4,9-10,12H,5-8,11H2,1-2H3/b4-3+ |
| InChIKey | BLAWHPBTELNOFF-ONEGZZNKSA-N |
| XLogP | 2.41 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|