C22H23ClN2O4 — CID 17489474
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-[4-(2-phenoxyethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 17489474) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-[4-(2-phenoxyethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-[4-(2-phenoxyethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 17489474 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-[4-(2-phenoxyethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C22H23ClN2O4/c23-19-14-17(15-20-22(19)29-16-28-20)6-7-21(26)25-10-8-24(9-11-25)12-13-27-18-4-2-1-3-5-18/h1-7,14-15H,8-13,16H2/b7-6+ |
| InChIKey | AWQKIFYZMLANIT-VOTSOKGWSA-N |
| XLogP | 3.31 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|