C22H23ClN2O3 — CID 9402331
(E)-1-(4-benzylpiperazin-1-yl)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one (PubChem CID 9402331) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is (E)-1-(4-benzylpiperazin-1-yl)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzylpiperazin-1-yl)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9402331 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (E)-1-(4-benzylpiperazin-1-yl)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H23ClN2O3/c23-19-14-18(15-20-22(19)28-13-12-27-20)6-7-21(26)25-10-8-24(9-11-25)16-17-4-2-1-3-5-17/h1-7,14-15H,8-13,16H2/b7-6+ |
| InChIKey | JXJOJXDUQJBGHR-VOTSOKGWSA-N |
| XLogP | 3.47 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|