C20H20ClFN2O — CID 9338593
(E)-1-(4-benzylpiperazin-1-yl)-3-(3-chloro-4-fluorophenyl)prop-2-en-1-one (PubChem CID 9338593) has the molecular formula C20H20ClFN2O and a molecular weight of 358.84 g/mol. Its IUPAC name is (E)-1-(4-benzylpiperazin-1-yl)-3-(3-chloro-4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzylpiperazin-1-yl)-3-(3-chloro-4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9338593 |
| Molecular Formula | C20H20ClFN2O |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (E)-1-(4-benzylpiperazin-1-yl)-3-(3-chloro-4-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(F)c(Cl)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H20ClFN2O/c21-18-14-16(6-8-19(18)22)7-9-20(25)24-12-10-23(11-13-24)15-17-4-2-1-3-5-17/h1-9,14H,10-13,15H2/b9-7+ |
| InChIKey | KSOBRWQIUYAOTL-VQHVLOKHSA-N |
| XLogP | 3.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|