C24H25ClN4O — CID 9092822
(E)-3-(1-benzylpyrazol-4-yl)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 9092822) has the molecular formula C24H25ClN4O and a molecular weight of 420.94 g/mol. Its IUPAC name is (E)-3-(1-benzylpyrazol-4-yl)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzylpyrazol-4-yl)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9092822 |
| Molecular Formula | C24H25ClN4O |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (E)-3-(1-benzylpyrazol-4-yl)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cnn(Cc2ccccc2)c1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H25ClN4O/c25-23-8-4-7-21(15-23)17-27-11-13-28(14-12-27)24(30)10-9-22-16-26-29(19-22)18-20-5-2-1-3-6-20/h1-10,15-16,19H,11-14,17-18H2/b10-9+ |
| InChIKey | MTLBENMQNDQAMF-MDZDMXLPSA-N |
| XLogP | 3.94 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|