C21H23ClN2O3 — CID 164625134
(E)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one (PubChem CID 164625134) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is (E)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 164625134 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (E)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(Cc3cccc(Cl)c3)CC2)ccc1O |
| InChI | InChI=1S/C21H23ClN2O3/c1-27-20-14-16(5-7-19(20)25)6-8-21(26)24-11-9-23(10-12-24)15-17-3-2-4-18(22)13-17/h2-8,13-14,25H,9-12,15H2,1H3/b8-6+ |
| InChIKey | QGFULWWYVZUOTH-SOFGYWHQSA-N |
| XLogP | 3.41 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|