C25H28N4O2 — CID 8966449
(E)-3-(1-benzylpyrazol-4-yl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 8966449) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is (E)-3-(1-benzylpyrazol-4-yl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzylpyrazol-4-yl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8966449 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (E)-3-(1-benzylpyrazol-4-yl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCOc1ccccc1N1CCN(C(=O)/C=C/c2cnn(Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H28N4O2/c1-2-31-24-11-7-6-10-23(24)27-14-16-28(17-15-27)25(30)13-12-22-18-26-29(20-22)19-21-8-4-3-5-9-21/h3-13,18,20H,2,14-17,19H2,1H3/b13-12+ |
| InChIKey | OJZUXPCLAPBFEZ-OUKQBFOZSA-N |
| XLogP | 3.69 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|