C21H23BrN2O2 — CID 9415392
(E)-3-(2-bromophenyl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 9415392) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-bromophenyl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9415392 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (E)-3-(2-bromophenyl)-1-[4-(2-ethoxyphenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCOc1ccccc1N1CCN(C(=O)/C=C/c2ccccc2Br)CC1 |
| InChI | InChI=1S/C21H23BrN2O2/c1-2-26-20-10-6-5-9-19(20)23-13-15-24(16-14-23)21(25)12-11-17-7-3-4-8-18(17)22/h3-12H,2,13-16H2,1H3/b12-11+ |
| InChIKey | IDMKDOPWQMDAPD-VAWYXSNFSA-N |
| XLogP | 4.21 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|