C18H22ClNO3 — CID 39754743
(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 39754743) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 39754743 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)/C=C/c2cc(Cl)c3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C18H22ClNO3/c1-12-7-13(2)11-20(10-12)17(21)4-3-14-8-15(19)18-16(9-14)22-5-6-23-18/h3-4,8-9,12-13H,5-7,10-11H2,1-2H3/b4-3+/t12-,13+ |
| InChIKey | RZOFRHXDKLAGKE-AYIQIARFSA-N |
| XLogP | 3.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|