C16H17F3N2O3 — CID 118715436
(E)-1-(4-methylpiperazin-1-yl)-3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]prop-2-en-1-one (PubChem CID 118715436) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is (E)-1-(4-methylpiperazin-1-yl)-3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-methylpiperazin-1-yl)-3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118715436 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (E)-1-(4-methylpiperazin-1-yl)-3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]prop-2-en-1-one |
| SMILES | CN1CCN(C(=O)/C=C/c2cc3c(c(C(F)(F)F)c2)OCO3)CC1 |
| InChI | InChI=1S/C16H17F3N2O3/c1-20-4-6-21(7-5-20)14(22)3-2-11-8-12(16(17,18)19)15-13(9-11)23-10-24-15/h2-3,8-9H,4-7,10H2,1H3/b3-2+ |
| InChIKey | ZCGZAKYLHDSUTH-NSCUHMNNSA-N |
| XLogP | 2.22 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|