C11H7F3O4 — CID 123498927
3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]prop-2-enoic acid (PubChem CID 123498927) has the molecular formula C11H7F3O4 and a molecular weight of 260.17 g/mol. Its IUPAC name is 3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123498927 |
| Molecular Formula | C11H7F3O4 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc2c(c(C(F)(F)F)c1)OCO2 |
| InChI | InChI=1S/C11H7F3O4/c12-11(13,14)7-3-6(1-2-9(15)16)4-8-10(7)18-5-17-8/h1-4H,5H2,(H,15,16) |
| InChIKey | MRGCZISQNLKDKE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|