C11H9F3O3 — CID 137488005
3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]propanal (PubChem CID 137488005) has the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. Its IUPAC name is 3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]propanal.
| Compound Name | 3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]propanal |
|---|---|
| PubChem CID | 137488005 |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 3-[7-(trifluoromethyl)-1,3-benzodioxol-5-yl]propanal |
| SMILES | O=CCCc1cc2c(c(C(F)(F)F)c1)OCO2 |
| InChI | InChI=1S/C11H9F3O3/c12-11(13,14)8-4-7(2-1-3-15)5-9-10(8)17-6-16-9/h3-5H,1-2,6H2 |
| InChIKey | IBKIZNQYGZDKGU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|