C10H8BrFO3 — CID 117439419
3-(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)propanal (PubChem CID 117439419) has the molecular formula C10H8BrFO3 and a molecular weight of 275.07 g/mol. Its IUPAC name is 3-(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)propanal.
| Compound Name | 3-(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)propanal |
|---|---|
| PubChem CID | 117439419 |
| Molecular Formula | C10H8BrFO3 |
| Molecular Weight | 275.07 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 3-(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)propanal |
| SMILES | O=CCCc1cc2c(c(Br)c1F)OCO2 |
| InChI | InChI=1S/C10H8BrFO3/c11-8-9(12)6(2-1-3-13)4-7-10(8)15-5-14-7/h3-4H,1-2,5H2 |
| InChIKey | MUWNAYGOHFIPMY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.07 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|