C10H8BrFO4 — CID 117469937
3-(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)propanoic acid (PubChem CID 117469937) has the molecular formula C10H8BrFO4 and a molecular weight of 291.07 g/mol. Its IUPAC name is 3-(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)propanoic acid.
| Compound Name | 3-(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 117469937 |
| Molecular Formula | C10H8BrFO4 |
| Molecular Weight | 291.07 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 3-(7-bromo-6-fluoro-1,3-benzodioxol-5-yl)propanoic acid |
| SMILES | O=C(O)CCc1cc2c(c(Br)c1F)OCO2 |
| InChI | InChI=1S/C10H8BrFO4/c11-8-9(12)5(1-2-7(13)14)3-6-10(8)16-4-15-6/h3H,1-2,4H2,(H,13,14) |
| InChIKey | DZMGYHWHVSOXHX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.07 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |