C10H9FO4 — CID 117302560
3-(5-fluoro-6-hydroxy-1,3-benzodioxol-4-yl)propanal (PubChem CID 117302560) has the molecular formula C10H9FO4 and a molecular weight of 212.18 g/mol. Its IUPAC name is 3-(5-fluoro-6-hydroxy-1,3-benzodioxol-4-yl)propanal.
| Compound Name | 3-(5-fluoro-6-hydroxy-1,3-benzodioxol-4-yl)propanal |
|---|---|
| PubChem CID | 117302560 |
| Molecular Formula | C10H9FO4 |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 3-(5-fluoro-6-hydroxy-1,3-benzodioxol-4-yl)propanal |
| SMILES | O=CCCc1c(F)c(O)cc2c1OCO2 |
| InChI | InChI=1S/C10H9FO4/c11-9-6(2-1-3-12)10-8(4-7(9)13)14-5-15-10/h3-4,13H,1-2,5H2 |
| InChIKey | QTTNMXWJCVYVGL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|