C9H10FNO3 — CID 117288236
6-(2-aminoethyl)-4-fluoro-1,3-benzodioxol-5-ol (PubChem CID 117288236) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is 6-(2-aminoethyl)-4-fluoro-1,3-benzodioxol-5-ol.
| Compound Name | 6-(2-aminoethyl)-4-fluoro-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117288236 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 6-(2-aminoethyl)-4-fluoro-1,3-benzodioxol-5-ol |
| SMILES | NCCc1cc2c(c(F)c1O)OCO2 |
| InChI | InChI=1S/C9H10FNO3/c10-7-8(12)5(1-2-11)3-6-9(7)14-4-13-6/h3,12H,1-2,4,11H2 |
| InChIKey | XHVRGYFNIDCFIJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |