C10H12FNO4 — CID 117329912
7-(2-aminooxyethyl)-5-fluoro-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 117329912) has the molecular formula C10H12FNO4 and a molecular weight of 229.21 g/mol. Its IUPAC name is 7-(2-aminooxyethyl)-5-fluoro-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 7-(2-aminooxyethyl)-5-fluoro-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 117329912 |
| Molecular Formula | C10H12FNO4 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 7-(2-aminooxyethyl)-5-fluoro-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | NOCCc1cc2c(c(F)c1O)OCCO2 |
| InChI | InChI=1S/C10H12FNO4/c11-8-9(13)6(1-2-16-12)5-7-10(8)15-4-3-14-7/h5,13H,1-4,12H2 |
| InChIKey | PSOMZRAGGVUQPL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|