C11H12F3NO3 — CID 117411889
O-[2-[6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]ethyl]hydroxylamine (PubChem CID 117411889) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is O-[2-[6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]ethyl]hydroxylamine.
| Compound Name | O-[2-[6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117411889 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | O-[2-[6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]ethyl]hydroxylamine |
| SMILES | NOCCc1cc2c(cc1C(F)(F)F)OCCO2 |
| InChI | InChI=1S/C11H12F3NO3/c12-11(13,14)8-6-10-9(16-3-4-17-10)5-7(8)1-2-18-15/h5-6H,1-4,15H2 |
| InChIKey | PWXIYLKZLWHIHE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|