C13H18FNO3 — CID 117391049
O-[2-[6-(2-fluoropropan-2-yl)-2,3-dihydro-1,4-benzodioxin-7-yl]ethyl]hydroxylamine (PubChem CID 117391049) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is O-[2-[6-(2-fluoropropan-2-yl)-2,3-dihydro-1,4-benzodioxin-7-yl]ethyl]hydroxylamine.
| Compound Name | O-[2-[6-(2-fluoropropan-2-yl)-2,3-dihydro-1,4-benzodioxin-7-yl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117391049 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | O-[2-[6-(2-fluoropropan-2-yl)-2,3-dihydro-1,4-benzodioxin-7-yl]ethyl]hydroxylamine |
| SMILES | CC(C)(F)c1cc2c(cc1CCON)OCCO2 |
| InChI | InChI=1S/C13H18FNO3/c1-13(2,14)10-8-12-11(16-5-6-17-12)7-9(10)3-4-18-15/h7-8H,3-6,15H2,1-2H3 |
| InChIKey | PTYIWWKYVSJAQZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|