C9H10BrNO3 — CID 117403795
O-[2-(6-bromo-1,3-benzodioxol-5-yl)ethyl]hydroxylamine (PubChem CID 117403795) has the molecular formula C9H10BrNO3 and a molecular weight of 260.09 g/mol. Its IUPAC name is O-[2-(6-bromo-1,3-benzodioxol-5-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(6-bromo-1,3-benzodioxol-5-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117403795 |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | O-[2-(6-bromo-1,3-benzodioxol-5-yl)ethyl]hydroxylamine |
| SMILES | NOCCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C9H10BrNO3/c10-7-4-9-8(12-5-13-9)3-6(7)1-2-14-11/h3-4H,1-2,5,11H2 |
| InChIKey | JHFQEQUCKBDPOI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|