About 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane
2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane (PubChem CID 11989001) has the molecular formula C18H29BrO3Si
and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane |
| PubChem CID | 11989001 |
| Molecular Formula | C18H29BrO3Si |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCCc1cc2c(cc1Br)OCO2)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H29BrO3Si/c1-12(2)23(13(3)4,14(5)6)22-8-7-15-9-17-18(10-16(15)19)21-11-20-17/h9-10,12-14H,7-8,11H2,1-6H3 |
| InChIKey | AKPKNVPKDOUOLN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane?
The IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane (CID 11989001) is 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane.
What is the SMILES notation for 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane?
The canonical SMILES for 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane is CC(C)[Si](OCCc1cc2c(cc1Br)OCO2)(C(C)C)C(C)C.
What is the InChIKey of 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane?
The InChIKey is AKPKNVPKDOUOLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29BrO3Si/c1-12(2)23(13(3)4,14(5)6)22-8-7-15-9-17-18(10-16(15)19)21-11-20-17/h9-10,12-14H,7-8,11H2,1-6H3.
What are the key properties of 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane?
2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane has a molecular weight of 401.42 g/mol, XLogP of 5.91, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane is sourced from PubChem (CID 11989001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).