C18H29BrO3Si — CID 11989001
2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane (PubChem CID 11989001) has the molecular formula C18H29BrO3Si and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane.
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11989001 |
| Molecular Formula | C18H29BrO3Si |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)ethoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCCc1cc2c(cc1Br)OCO2)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H29BrO3Si/c1-12(2)23(13(3)4,14(5)6)22-8-7-15-9-17-18(10-16(15)19)21-11-20-17/h9-10,12-14H,7-8,11H2,1-6H3 |
| InChIKey | AKPKNVPKDOUOLN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|