C20H32O3Si — CID 11405342
[(E)-4-(1,3-benzodioxol-5-yl)but-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 11405342) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is [(E)-4-(1,3-benzodioxol-5-yl)but-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E)-4-(1,3-benzodioxol-5-yl)but-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11405342 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(E)-4-(1,3-benzodioxol-5-yl)but-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCC/C=C/c1ccc2c(c1)OCO2)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H32O3Si/c1-15(2)24(16(3)4,17(5)6)23-12-8-7-9-18-10-11-19-20(13-18)22-14-21-19/h7,9-11,13,15-17H,8,12,14H2,1-6H3/b9-7+ |
| InChIKey | JCFVQEVLCDVOIS-VQHVLOKHSA-N |
| XLogP | 6.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|