C17H24O3Si — CID 11278125
[(1Z,4E)-5-(1,3-benzodioxol-5-yl)-2-(methoxymethyl)penta-1,4-dienyl]-trimethylsilane (PubChem CID 11278125) has the molecular formula C17H24O3Si and a molecular weight of 304.46 g/mol. Its IUPAC name is [(1Z,4E)-5-(1,3-benzodioxol-5-yl)-2-(methoxymethyl)penta-1,4-dienyl]-trimethylsilane.
| Compound Name | [(1Z,4E)-5-(1,3-benzodioxol-5-yl)-2-(methoxymethyl)penta-1,4-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 11278125 |
| Molecular Formula | C17H24O3Si |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(1Z,4E)-5-(1,3-benzodioxol-5-yl)-2-(methoxymethyl)penta-1,4-dienyl]-trimethylsilane |
| SMILES | COC/C(=C\[Si](C)(C)C)C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H24O3Si/c1-18-11-15(12-21(2,3)4)7-5-6-14-8-9-16-17(10-14)20-13-19-16/h5-6,8-10,12H,7,11,13H2,1-4H3/b6-5+,15-12- |
| InChIKey | FEYFQUXFOYCURQ-FBBMYGJOSA-N |
| XLogP | 4.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|