C16H14O2 — CID 154074400
5-(3-phenylprop-1-enyl)-1,3-benzodioxole (PubChem CID 154074400) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-(3-phenylprop-1-enyl)-1,3-benzodioxole.
| Compound Name | 5-(3-phenylprop-1-enyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 154074400 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 5-(3-phenylprop-1-enyl)-1,3-benzodioxole |
| SMILES | C(=Cc1ccc2c(c1)OCO2)Cc1ccccc1 |
| InChI | InChI=1S/C16H14O2/c1-2-5-13(6-3-1)7-4-8-14-9-10-15-16(11-14)18-12-17-15/h1-6,8-11H,7,12H2 |
| InChIKey | ASYLOCFJGFOCMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |