C16H20O5 — CID 10968306
3-hydroxypropyl (E)-6-(1,3-benzodioxol-5-yl)hex-5-enoate (PubChem CID 10968306) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-hydroxypropyl (E)-6-(1,3-benzodioxol-5-yl)hex-5-enoate.
| Compound Name | 3-hydroxypropyl (E)-6-(1,3-benzodioxol-5-yl)hex-5-enoate |
|---|---|
| PubChem CID | 10968306 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-hydroxypropyl (E)-6-(1,3-benzodioxol-5-yl)hex-5-enoate |
| SMILES | O=C(CCC/C=C/c1ccc2c(c1)OCO2)OCCCO |
| InChI | InChI=1S/C16H20O5/c17-9-4-10-19-16(18)6-3-1-2-5-13-7-8-14-15(11-13)21-12-20-14/h2,5,7-8,11,17H,1,3-4,6,9-10,12H2/b5-2+ |
| InChIKey | NKRQJFQOEAMUEA-GORDUTHDSA-N |
| XLogP | 2.52 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|