C9H10BrNO3 — CID 115279443
1-(6-bromo-1,3-benzodioxol-5-yl)-N-methoxymethanamine (PubChem CID 115279443) has the molecular formula C9H10BrNO3 and a molecular weight of 260.09 g/mol. Its IUPAC name is 1-(6-bromo-1,3-benzodioxol-5-yl)-N-methoxymethanamine.
| Compound Name | 1-(6-bromo-1,3-benzodioxol-5-yl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 115279443 |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 1-(6-bromo-1,3-benzodioxol-5-yl)-N-methoxymethanamine |
| SMILES | CONCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C9H10BrNO3/c1-12-11-4-6-2-8-9(3-7(6)10)14-5-13-8/h2-3,11H,4-5H2,1H3 |
| InChIKey | WRCLVJMGXOMHLD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|