C10H9BrF3NO3 — CID 82710639
1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82710639) has the molecular formula C10H9BrF3NO3 and a molecular weight of 328.08 g/mol. Its IUPAC name is 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82710639 |
| Molecular Formula | C10H9BrF3NO3 |
| Molecular Weight | 328.08 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | FC(F)(F)CONCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C10H9BrF3NO3/c11-7-2-9-8(16-5-17-9)1-6(7)3-15-18-4-10(12,13)14/h1-2,15H,3-5H2 |
| InChIKey | GTBFJPFDLBVILV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.08 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|