C11H13BrFNO2 — CID 115733052
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3-fluoropropan-1-amine (PubChem CID 115733052) has the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3-fluoropropan-1-amine.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 115733052 |
| Molecular Formula | C11H13BrFNO2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3-fluoropropan-1-amine |
| SMILES | FCCCNCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C11H13BrFNO2/c12-9-5-11-10(15-7-16-11)4-8(9)6-14-3-1-2-13/h4-5,14H,1-3,6-7H2 |
| InChIKey | FQDKHIQHSMFFEA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|