C14H14BrNO2S — CID 43392051
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-thiophen-2-ylethanamine (PubChem CID 43392051) has the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 43392051 |
| Molecular Formula | C14H14BrNO2S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-thiophen-2-ylethanamine |
| SMILES | Brc1cc2c(cc1CNCCc1cccs1)OCO2 |
| InChI | InChI=1S/C14H14BrNO2S/c15-12-7-14-13(17-9-18-14)6-10(12)8-16-4-3-11-2-1-5-19-11/h1-2,5-7,16H,3-4,8-9H2 |
| InChIKey | LDHYDGONMPXRBC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|