C12H16BrNO3S — CID 113237593
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethylsulfinylethanamine (PubChem CID 113237593) has the molecular formula C12H16BrNO3S and a molecular weight of 334.24 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethylsulfinylethanamine.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethylsulfinylethanamine |
|---|---|
| PubChem CID | 113237593 |
| Molecular Formula | C12H16BrNO3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-ethylsulfinylethanamine |
| SMILES | CCS(=O)CCNCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C12H16BrNO3S/c1-2-18(15)4-3-14-7-9-5-11-12(6-10(9)13)17-8-16-11/h5-6,14H,2-4,7-8H2,1H3 |
| InChIKey | LCZZHONXLLYGHQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|