C11H15BrN2O2 — CID 60887613
N'-[(6-bromo-1,3-benzodioxol-5-yl)methyl]propane-1,3-diamine (PubChem CID 60887613) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is N'-[(6-bromo-1,3-benzodioxol-5-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(6-bromo-1,3-benzodioxol-5-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60887613 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | N'-[(6-bromo-1,3-benzodioxol-5-yl)methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C11H15BrN2O2/c12-9-5-11-10(15-7-16-11)4-8(9)6-14-3-1-2-13/h4-5,14H,1-3,6-7,13H2 |
| InChIKey | WNJIEWWTPKSQFO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|