C8H9BrN2O2 — CID 16772287
(6-bromo-1,3-benzodioxol-5-yl)methylhydrazine (PubChem CID 16772287) has the molecular formula C8H9BrN2O2 and a molecular weight of 245.08 g/mol. Its IUPAC name is (6-bromo-1,3-benzodioxol-5-yl)methylhydrazine.
| Compound Name | (6-bromo-1,3-benzodioxol-5-yl)methylhydrazine |
|---|---|
| PubChem CID | 16772287 |
| Molecular Formula | C8H9BrN2O2 |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | (6-bromo-1,3-benzodioxol-5-yl)methylhydrazine |
| SMILES | NNCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C8H9BrN2O2/c9-6-2-8-7(12-4-13-8)1-5(6)3-11-10/h1-2,11H,3-4,10H2 |
| InChIKey | GFBRHYMIPPWCNK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|