C13H18BrNO2S — CID 104754347
N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-ethylsulfinylethanamine (PubChem CID 104754347) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-ethylsulfinylethanamine.
| Compound Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-ethylsulfinylethanamine |
|---|---|
| PubChem CID | 104754347 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-ethylsulfinylethanamine |
| SMILES | CCS(=O)CCNCc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H18BrNO2S/c1-2-18(16)6-4-15-9-11-8-12(14)7-10-3-5-17-13(10)11/h7-8,15H,2-6,9H2,1H3 |
| InChIKey | FOBVPZHBKAMKGV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|