C13H17Br2NO — CID 106844878
4-bromo-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]butan-1-amine (PubChem CID 106844878) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]butan-1-amine.
| Compound Name | 4-bromo-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844878 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 4-bromo-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]butan-1-amine |
| SMILES | BrCCCCNCc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H17Br2NO/c14-4-1-2-5-16-9-11-8-12(15)7-10-3-6-17-13(10)11/h7-8,16H,1-6,9H2 |
| InChIKey | SVLIYERYSIAHGP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|