C13H18BrNO2 — CID 113403288
4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methylamino]butan-2-ol (PubChem CID 113403288) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methylamino]butan-2-ol.
| Compound Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 113403288 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methylamino]butan-2-ol |
| SMILES | CC(O)CCNCc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H18BrNO2/c1-9(16)2-4-15-8-11-7-12(14)6-10-3-5-17-13(10)11/h6-7,9,15-16H,2-5,8H2,1H3 |
| InChIKey | YLGFMJNMEFKSTL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|