C15H22BrNO3 — CID 104702398
N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2,2-diethoxyethanamine (PubChem CID 104702398) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2,2-diethoxyethanamine.
| Compound Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 104702398 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1cc(Br)cc2c1OCC2)OCC |
| InChI | InChI=1S/C15H22BrNO3/c1-3-18-14(19-4-2)10-17-9-12-8-13(16)7-11-5-6-20-15(11)12/h7-8,14,17H,3-6,9-10H2,1-2H3 |
| InChIKey | SOAKXDPFKNVZHM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|