C13H15BrClNO3 — CID 103491894
methyl 3-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methylamino]-2-chloropropanoate (PubChem CID 103491894) has the molecular formula C13H15BrClNO3 and a molecular weight of 348.62 g/mol. Its IUPAC name is methyl 3-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methylamino]-2-chloropropanoate.
| Compound Name | methyl 3-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methylamino]-2-chloropropanoate |
|---|---|
| PubChem CID | 103491894 |
| Molecular Formula | C13H15BrClNO3 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | methyl 3-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methylamino]-2-chloropropanoate |
| SMILES | COC(=O)C(Cl)CNCc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H15BrClNO3/c1-18-13(17)11(15)7-16-6-9-5-10(14)4-8-2-3-19-12(8)9/h4-5,11,16H,2-3,6-7H2,1H3 |
| InChIKey | ICJBAPAMTZNDPB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|