C14H15NO2S — CID 39361390
N-(1,3-benzodioxol-5-ylmethyl)-2-thiophen-2-ylethanamine (PubChem CID 39361390) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-thiophen-2-ylethanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 39361390 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-thiophen-2-ylethanamine |
| SMILES | c1csc(CCNCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C14H15NO2S/c1-2-12(18-7-1)5-6-15-9-11-3-4-13-14(8-11)17-10-16-13/h1-4,7-8,15H,5-6,9-10H2 |
| InChIKey | KBWGYKCFUSVDMT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|