C17H19NO3S — CID 110297708
N-(1,3-benzodioxol-5-ylmethyl)-5-thiophen-2-ylpentanamide (PubChem CID 110297708) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-thiophen-2-ylpentanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 110297708 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-thiophen-2-ylpentanamide |
| SMILES | O=C(CCCCc1cccs1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H19NO3S/c19-17(6-2-1-4-14-5-3-9-22-14)18-11-13-7-8-15-16(10-13)21-12-20-15/h3,5,7-10H,1-2,4,6,11-12H2,(H,18,19) |
| InChIKey | MPPCMWTZMHCCTK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|