C10H12FNO2 — CID 80695679
N-(1,3-benzodioxol-5-ylmethyl)-2-fluoroethanamine (PubChem CID 80695679) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-fluoroethanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 80695679 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-fluoroethanamine |
| SMILES | FCCNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H12FNO2/c11-3-4-12-6-8-1-2-9-10(5-8)14-7-13-9/h1-2,5,12H,3-4,6-7H2 |
| InChIKey | SJODAEWFJMRILI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|