C12H16BrNO3 — CID 171619209
2-[3-(6-bromo-1,3-benzodioxol-5-yl)propylamino]ethanol (PubChem CID 171619209) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 2-[3-(6-bromo-1,3-benzodioxol-5-yl)propylamino]ethanol.
| Compound Name | 2-[3-(6-bromo-1,3-benzodioxol-5-yl)propylamino]ethanol |
|---|---|
| PubChem CID | 171619209 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-[3-(6-bromo-1,3-benzodioxol-5-yl)propylamino]ethanol |
| SMILES | OCCNCCCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C12H16BrNO3/c13-10-7-12-11(16-8-17-12)6-9(10)2-1-3-14-4-5-15/h6-7,14-15H,1-5,8H2 |
| InChIKey | ZXTHCCKIHNLVNN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|