C12H16O4 — CID 91665287
3-[6-(2-hydroxyethyl)-1,3-benzodioxol-5-yl]propan-1-ol (PubChem CID 91665287) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-[6-(2-hydroxyethyl)-1,3-benzodioxol-5-yl]propan-1-ol.
| Compound Name | 3-[6-(2-hydroxyethyl)-1,3-benzodioxol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 91665287 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-[6-(2-hydroxyethyl)-1,3-benzodioxol-5-yl]propan-1-ol |
| SMILES | OCCCc1cc2c(cc1CCO)OCO2 |
| InChI | InChI=1S/C12H16O4/c13-4-1-2-9-6-11-12(16-8-15-11)7-10(9)3-5-14/h6-7,13-14H,1-5,8H2 |
| InChIKey | SNKYFWHQYXFICH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |